CAS 2232870-66-3 appears in our catalog under these names: N6–Methyladenosine–13C, N6-Methyladenosine-13C, 99.91%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
(2R,4S,5R)-2-(hydroxymethyl)-5-[6-((113C)methylamino)purin-9-yl]oxolane-3,4-diol (CAS 2232870-66-3) is a chemical compound with the molecular formula C11H15N5O4 and a molecular weight of 282.26 g/mol. IUPAC name: (2R,4S,5R)-2-(hydroxymethyl)-5-[6-((113C)methylamino)purin-9-yl]oxolane-3,4-diol. InChIKey: VQAYFKKCNSOZKM-YYWCNEATSA-N.
| Molecular formula | C11H15N5O4 |
|---|---|
| Molecular weight | 282.26 g/mol |
| IUPAC name | (2R,4S,5R)-2-(hydroxymethyl)-5-[6-((113C)methylamino)purin-9-yl]oxolane-3,4-diol |
| InChIKey | VQAYFKKCNSOZKM-YYWCNEATSA-N |
| SMILES | [13CH3]NC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@H](C([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)