Products 1399656-07-5
CAS 1399656-07-5 appears in our catalog under these names: 1-(4-Bromo-phenoxy)-cyclopropanecarboxylic acid, 95%, 1-(4-Bromo-phenoxy)-cyclopropanecarboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 50mg, 0,5g.
1-(4-bromophenoxy)cyclopropane-1-carboxylic acid (CAS 1399656-07-5) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: 1-(4-bromophenoxy)cyclopropane-1-carboxylic acid. InChIKey: GTSZPWVQZJYPEB-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO3 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | 1-(4-bromophenoxy)cyclopropane-1-carboxylic acid |
| InChIKey | GTSZPWVQZJYPEB-UHFFFAOYSA-N |
| SMILES | C1CC1(C(=O)O)OC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)