Products 1399663-70-7
CAS 1399663-70-7 appears in our catalog under these names: 5-Bromo-1-(O-Tolyl)-1H-Pyrazole-4-Carboxylic Acid, 97%, 97%, 5-Bromo-1-(O-tolyl)-1H-pyrazole-4-carboxylic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-1-(2-methylphenyl)pyrazole-4-carboxylic acid (CAS 1399663-70-7) is a chemical compound with the molecular formula C11H9BrN2O2 and a molecular weight of 281.10 g/mol. IUPAC name: 5-bromo-1-(2-methylphenyl)pyrazole-4-carboxylic acid. InChIKey: ONSLCBBOIHIQJW-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O2 |
|---|---|
| Molecular weight | 281.10 g/mol |
| IUPAC name | 5-bromo-1-(2-methylphenyl)pyrazole-4-carboxylic acid |
| InChIKey | ONSLCBBOIHIQJW-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N2C(=C(C=N2)C(=O)O)Br |
Computed by PubChem (NCBI)