CAS 1400635-79-1 is the registry number for 5-Isopropyl-5,6-dihydro-4H-thieno[2,3-c]pyrrole-2-carboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid (CAS 1400635-79-1) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid. InChIKey: BEGYOGVGUZNINM-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | 5-propan-2-yl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid |
| InChIKey | BEGYOGVGUZNINM-UHFFFAOYSA-N |
| SMILES | CC(C)N1CC2=C(C1)SC(=C2)C(=O)O |
Computed by PubChem (NCBI)