Products 1400706-90-2
CAS 1400706-90-2 appears in our catalog under these names: 5-(4-Bromo-2,6-difluorophenyl)oxazole, 95%, 5-(4-Bromo-2,6-difluorophenyl)oxazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
5-(4-bromo-2,6-difluorophenyl)-1,3-oxazole (CAS 1400706-90-2) is a chemical compound with the molecular formula C9H4BrF2NO and a molecular weight of 260.03 g/mol. IUPAC name: 5-(4-bromo-2,6-difluorophenyl)-1,3-oxazole. InChIKey: KMRGNRRHIIGEKH-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF2NO |
|---|---|
| Molecular weight | 260.03 g/mol |
| IUPAC name | 5-(4-bromo-2,6-difluorophenyl)-1,3-oxazole |
| InChIKey | KMRGNRRHIIGEKH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C2=CN=CO2)F)Br |
Computed by PubChem (NCBI)