Products 2379321-77-2
CAS 2379321-77-2 is the registry number for 5-(4-Bromo-2,3-difluorophenyl)oxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
5-(4-bromo-2,3-difluorophenyl)-1,3-oxazole (CAS 2379321-77-2) is a chemical compound with the molecular formula C9H4BrF2NO and a molecular weight of 260.03 g/mol. IUPAC name: 5-(4-bromo-2,3-difluorophenyl)-1,3-oxazole. InChIKey: TWJMEDDCKPOJHM-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF2NO |
|---|---|
| Molecular weight | 260.03 g/mol |
| IUPAC name | 5-(4-bromo-2,3-difluorophenyl)-1,3-oxazole |
| InChIKey | TWJMEDDCKPOJHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C2=CN=CO2)F)F)Br |
Computed by PubChem (NCBI)