Products 2364585-22-6
CAS 2364585-22-6 appears in our catalog under these names: 5-(6-Bromo-2,3-difluorophenyl)oxazole, 5-(6-Bromo-2,3-difluorophenyl)oxazole, 95%, 5-(6-bromo-2,3-difluorophenyl)oxazole, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 250mg.
5-(6-bromo-2,3-difluorophenyl)-1,3-oxazole (CAS 2364585-22-6) is a chemical compound with the molecular formula C9H4BrF2NO and a molecular weight of 260.03 g/mol. IUPAC name: 5-(6-bromo-2,3-difluorophenyl)-1,3-oxazole. InChIKey: PILVMNWDLPRZOG-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF2NO |
|---|---|
| Molecular weight | 260.03 g/mol |
| IUPAC name | 5-(6-bromo-2,3-difluorophenyl)-1,3-oxazole |
| InChIKey | PILVMNWDLPRZOG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)F)C2=CN=CO2)Br |
Computed by PubChem (NCBI)