Products 2364585-03-3
CAS 2364585-03-3 appears in our catalog under these names: 5-(2-Bromo-3,6-difluorophenyl)oxazole, 95%, 5-(2-Bromo-3,6-difluorophenyl)oxazole. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
5-(2-bromo-3,6-difluorophenyl)-1,3-oxazole (CAS 2364585-03-3) is a chemical compound with the molecular formula C9H4BrF2NO and a molecular weight of 260.03 g/mol. IUPAC name: 5-(2-bromo-3,6-difluorophenyl)-1,3-oxazole. InChIKey: DNHWHLSHDKHAFV-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF2NO |
|---|---|
| Molecular weight | 260.03 g/mol |
| IUPAC name | 5-(2-bromo-3,6-difluorophenyl)-1,3-oxazole |
| InChIKey | DNHWHLSHDKHAFV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C2=CN=CO2)Br)F |
Computed by PubChem (NCBI)