CAS 140112-97-6 appears in our catalog under these names: Methyl 5-amino-2,4-dimethylbenzoate, 95%, Methyl 5-amino-2,4-dimethylbenzoate, 98+%, Methyl 5-amino-2,4-dimethylbenzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 10g.
Methyl 5-amino-2,4-dimethylbenzoate (CAS 140112-97-6) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl 5-amino-2,4-dimethylbenzoate. InChIKey: UGIWJVRYBRJDGI-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | methyl 5-amino-2,4-dimethylbenzoate |
| InChIKey | UGIWJVRYBRJDGI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)OC)N)C |
Computed by PubChem (NCBI)