CAS 1401521-92-3 is the registry number for Ethyl 5-(3-nitrophenyl)-1,3,4-oxadiazole-2-carboxylate, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl 5-(3-nitrophenyl)-1,3,4-oxadiazole-2-carboxylate (CAS 1401521-92-3) is a chemical compound with the molecular formula C11H9N3O5 and a molecular weight of 263.21 g/mol. IUPAC name: ethyl 5-(3-nitrophenyl)-1,3,4-oxadiazole-2-carboxylate. InChIKey: QGSJPSGGSCHNRY-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O5 |
|---|---|
| Molecular weight | 263.21 g/mol |
| IUPAC name | ethyl 5-(3-nitrophenyl)-1,3,4-oxadiazole-2-carboxylate |
| InChIKey | QGSJPSGGSCHNRY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN=C(O1)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)