Products 554436-87-2
CAS 554436-87-2 appears in our catalog under these names: 2-Cyano-n-(7-nitro-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide, 95%, 2-Cyano-N-(7-nitro-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-cyano-N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)acetamide (CAS 554436-87-2) is a chemical compound with the molecular formula C11H9N3O5 and a molecular weight of 263.21 g/mol. IUPAC name: 2-cyano-N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)acetamide. InChIKey: GNOYBLOYMSSKNJ-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O5 |
|---|---|
| Molecular weight | 263.21 g/mol |
| IUPAC name | 2-cyano-N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)acetamide |
| InChIKey | GNOYBLOYMSSKNJ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)[N+](=O)[O-])NC(=O)CC#N |
Computed by PubChem (NCBI)