CAS 82551-63-1 appears in our catalog under these names: 4-Nitrobenzyl2-diazoacetoacetate, >95% (HPLC), 4–Nitrobenzyl 2–diazo–3–oxobutanoate. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 250mg, 50mg, 100g, 500g.
(4-nitrophenyl)methyl 2-diazo-3-oxobutanoate (CAS 82551-63-1) is a chemical compound with the molecular formula C11H9N3O5 and a molecular weight of 263.21 g/mol. IUPAC name: (4-nitrophenyl)methyl 2-diazo-3-oxobutanoate. InChIKey: HEKGSEIAAGMGPL-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O5 |
|---|---|
| Molecular weight | 263.21 g/mol |
| IUPAC name | (4-nitrophenyl)methyl 2-diazo-3-oxobutanoate |
| InChIKey | HEKGSEIAAGMGPL-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=[N+]=[N-])C(=O)OCC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)