Products 1429417-82-2

CAS 1429417-82-2 is the registry number for 4-((1-Methyl-4-nitro-1H-pyrazol-3-yl)oxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-(1-methyl-4-nitropyrazol-3-yl)oxybenzoic acid (CAS 1429417-82-2) is a chemical compound with the molecular formula C11H9N3O5 and a molecular weight of 263.21 g/mol. IUPAC name: 4-(1-methyl-4-nitropyrazol-3-yl)oxybenzoic acid. InChIKey: OJQONFWSGXETFI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9N3O5
Molecular weight263.21 g/mol
IUPAC name4-(1-methyl-4-nitropyrazol-3-yl)oxybenzoic acid
InChIKeyOJQONFWSGXETFI-UHFFFAOYSA-N
SMILESCN1C=C(C(=N1)OC2=CC=C(C=C2)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)