CAS 14017-71-1 appears in our catalog under these names: (-)-Praeruptorin A, Isopteryxin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 0,25mg, 5 mg, 1 mg.
[(9R,10R)-10-acetyloxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] (Z)-2-methylbut-2-enoate (CAS 14017-71-1) is a chemical compound with the molecular formula C21H22O7 and a molecular weight of 386.4 g/mol. IUPAC name: [(9R,10R)-10-acetyloxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] (Z)-2-methylbut-2-enoate. InChIKey: XGPBRZDOJDLKOT-YRCPKEQFSA-N.
| Molecular formula | C21H22O7 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | [(9R,10R)-10-acetyloxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] (Z)-2-methylbut-2-enoate |
| InChIKey | XGPBRZDOJDLKOT-YRCPKEQFSA-N |
| SMILES | C/C=C(/C)\C(=O)O[C@@H]1[C@@H](C2=C(C=CC3=C2OC(=O)C=C3)OC1(C)C)OC(=O)C |
Computed by PubChem (NCBI)