CAS 140217-83-0 appears in our catalog under these names: Tert-Butyl 6-hydroxy-1,4-thiazepane-4-carboxylate 1,1-dioxide, 98%, 98%, tert-Butyl 6-hydroxy-1,4-thiazepane-4-carboxylate 1,1-dioxide, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Tert-butyl 6-hydroxy-1,1-dioxo-1,4-thiazepane-4-carboxylate (CAS 140217-83-0) is a chemical compound with the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. IUPAC name: tert-butyl 6-hydroxy-1,1-dioxo-1,4-thiazepane-4-carboxylate. InChIKey: QSZMARFNYYIRFU-UHFFFAOYSA-N.
| Molecular formula | C10H19NO5S |
|---|---|
| Molecular weight | 265.33 g/mol |
| IUPAC name | tert-butyl 6-hydroxy-1,1-dioxo-1,4-thiazepane-4-carboxylate |
| InChIKey | QSZMARFNYYIRFU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCS(=O)(=O)CC(C1)O |
Computed by PubChem (NCBI)