CAS 140240-75-1 appears in our catalog under these names: Albendazole Impurity 13, Albendazole Impurity 19. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
6-propylsulfinyl-1H-benzimidazol-2-amine (CAS 140240-75-1) is a chemical compound with the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. IUPAC name: 6-propylsulfinyl-1H-benzimidazol-2-amine. InChIKey: XACOMYIQGVIQDV-UHFFFAOYSA-N.
| Molecular formula | C10H13N3OS |
|---|---|
| Molecular weight | 223.30 g/mol |
| IUPAC name | 6-propylsulfinyl-1H-benzimidazol-2-amine |
| InChIKey | XACOMYIQGVIQDV-UHFFFAOYSA-N |
| SMILES | CCCS(=O)C1=CC2=C(C=C1)N=C(N2)N |
Computed by PubChem (NCBI)