CAS 932796-38-8 appears in our catalog under these names: 3-Amino-6-isopropyl-2-methylthieno[2,3-d]pyrimidin-4(3h)-one, 95%, 3-Amino-6-isopropyl-2-methylthieno(2,3-d)pyrimidin-4(3H)-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-amino-2-methyl-6-propan-2-ylthieno[2,3-d]pyrimidin-4-one (CAS 932796-38-8) is a chemical compound with the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. IUPAC name: 3-amino-2-methyl-6-propan-2-ylthieno[2,3-d]pyrimidin-4-one. InChIKey: FOQUHZMZUKIJHO-UHFFFAOYSA-N.
| Molecular formula | C10H13N3OS |
|---|---|
| Molecular weight | 223.30 g/mol |
| IUPAC name | 3-amino-2-methyl-6-propan-2-ylthieno[2,3-d]pyrimidin-4-one |
| InChIKey | FOQUHZMZUKIJHO-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(S2)C(C)C)C(=O)N1N |
Computed by PubChem (NCBI)