CAS 588682-90-0 appears in our catalog under these names: 4-Isopropyl-5-(2-methyl-3-furyl)-4h-1,2,4-triazole-3-thiol, 95%, 4-Isopropyl-5-(2-methylfuran-3-yl)-4H-1,2,4-triazole-3-thiol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-(2-methylfuran-3-yl)-4-propan-2-yl-1H-1,2,4-triazole-5-thione (CAS 588682-90-0) is a chemical compound with the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. IUPAC name: 3-(2-methylfuran-3-yl)-4-propan-2-yl-1H-1,2,4-triazole-5-thione. InChIKey: WBPVSDCVYRJDRM-UHFFFAOYSA-N.
| Molecular formula | C10H13N3OS |
|---|---|
| Molecular weight | 223.30 g/mol |
| IUPAC name | 3-(2-methylfuran-3-yl)-4-propan-2-yl-1H-1,2,4-triazole-5-thione |
| InChIKey | WBPVSDCVYRJDRM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CO1)C2=NNC(=S)N2C(C)C |
Computed by PubChem (NCBI)