CAS 851169-60-3 is the registry number for N-(4-tert-Butyl-1,3-thiazol-2-yl)-2-cyanoacetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-(4-tert-butyl-1,3-thiazol-2-yl)-2-cyanoacetamide (CAS 851169-60-3) is a chemical compound with the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. IUPAC name: N-(4-tert-butyl-1,3-thiazol-2-yl)-2-cyanoacetamide. InChIKey: KELKOCKBZGULER-UHFFFAOYSA-N.
| Molecular formula | C10H13N3OS |
|---|---|
| Molecular weight | 223.30 g/mol |
| IUPAC name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-cyanoacetamide |
| InChIKey | KELKOCKBZGULER-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CSC(=N1)NC(=O)CC#N |
Computed by PubChem (NCBI)