CAS 84272-90-2 is the registry number for Ethyl-alpha,alpha-d2-benzene-d5, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
1,2,3,4,5-pentadeuterio-6-(1,1-dideuterioethyl)benzene (CAS 84272-90-2) is a chemical compound with the molecular formula C8H10 and a molecular weight of 113.21 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(1,1-dideuterioethyl)benzene. InChIKey: YNQLUTRBYVCPMQ-GGTYFICESA-N.
| Molecular formula | C8H10 |
|---|---|
| Molecular weight | 113.21 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-(1,1-dideuterioethyl)benzene |
| InChIKey | YNQLUTRBYVCPMQ-GGTYFICESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C)[2H])[2H] |
Computed by PubChem (NCBI)