Products 1861-01-4

CAS 1861-01-4 is the registry number for Ethyl-alpha,alpha-d2-benzene, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.

Structural formula: {0} (CAS {1})

1,1-dideuterioethylbenzene (CAS 1861-01-4) is a chemical compound with the molecular formula C8H10 and a molecular weight of 108.18 g/mol. IUPAC name: 1,1-dideuterioethylbenzene. InChIKey: YNQLUTRBYVCPMQ-CBTSVUPCSA-N.

Identity
Molecular formulaC8H10
Molecular weight108.18 g/mol
IUPAC name1,1-dideuterioethylbenzene
InChIKeyYNQLUTRBYVCPMQ-CBTSVUPCSA-N
SMILES[2H]C([2H])(C)C1=CC=CC=C1

Computed by PubChem (NCBI)