CAS 1861-01-4 is the registry number for Ethyl-alpha,alpha-d2-benzene, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
1,1-dideuterioethylbenzene (CAS 1861-01-4) is a chemical compound with the molecular formula C8H10 and a molecular weight of 108.18 g/mol. IUPAC name: 1,1-dideuterioethylbenzene. InChIKey: YNQLUTRBYVCPMQ-CBTSVUPCSA-N.
| Molecular formula | C8H10 |
|---|---|
| Molecular weight | 108.18 g/mol |
| IUPAC name | 1,1-dideuterioethylbenzene |
| InChIKey | YNQLUTRBYVCPMQ-CBTSVUPCSA-N |
| SMILES | [2H]C([2H])(C)C1=CC=CC=C1 |
Computed by PubChem (NCBI)