Products 1403763-71-2

CAS 1403763-71-2 is the registry number for Methyl 4-bromo-2-chloro-1,3-benzothiazole-6-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 4-bromo-2-chloro-1,3-benzothiazole-6-carboxylate (CAS 1403763-71-2) is a chemical compound with the molecular formula C9H5BrClNO2S and a molecular weight of 306.56 g/mol. IUPAC name: methyl 4-bromo-2-chloro-1,3-benzothiazole-6-carboxylate. InChIKey: PHFCEUOOJPKEGR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5BrClNO2S
Molecular weight306.56 g/mol
IUPAC namemethyl 4-bromo-2-chloro-1,3-benzothiazole-6-carboxylate
InChIKeyPHFCEUOOJPKEGR-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC2=C(C(=C1)Br)N=C(S2)Cl

Computed by PubChem (NCBI)