CAS 1403763-71-2 is the registry number for Methyl 4-bromo-2-chloro-1,3-benzothiazole-6-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl 4-bromo-2-chloro-1,3-benzothiazole-6-carboxylate (CAS 1403763-71-2) is a chemical compound with the molecular formula C9H5BrClNO2S and a molecular weight of 306.56 g/mol. IUPAC name: methyl 4-bromo-2-chloro-1,3-benzothiazole-6-carboxylate. InChIKey: PHFCEUOOJPKEGR-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO2S |
|---|---|
| Molecular weight | 306.56 g/mol |
| IUPAC name | methyl 4-bromo-2-chloro-1,3-benzothiazole-6-carboxylate |
| InChIKey | PHFCEUOOJPKEGR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C(=C1)Br)N=C(S2)Cl |
Computed by PubChem (NCBI)