CAS 33768-83-1 appears in our catalog under these names: 3-Bromoquinoline-5-sulfonyl chloride, 95%, 3-Bromoquinoline-5-sulfonyl chloride, 98%, 98%, 3-BROMOQUINOLINE-5-SULFONYL CHLORIDE, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
3-bromoquinoline-5-sulfonyl chloride (CAS 33768-83-1) is a chemical compound with the molecular formula C9H5BrClNO2S and a molecular weight of 306.56 g/mol. IUPAC name: 3-bromoquinoline-5-sulfonyl chloride. InChIKey: ZXXRATLUSBGZLN-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO2S |
|---|---|
| Molecular weight | 306.56 g/mol |
| IUPAC name | 3-bromoquinoline-5-sulfonyl chloride |
| InChIKey | ZXXRATLUSBGZLN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)Br)C(=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)