CAS 98591-39-0 appears in our catalog under these names: 6-Bromoquinoline-8-sulfonyl chloride, 95%, 6-Bromoquinoline-8-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 50mg, 0,5g.
6-bromoquinoline-8-sulfonyl chloride (CAS 98591-39-0) is a chemical compound with the molecular formula C9H5BrClNO2S and a molecular weight of 306.56 g/mol. IUPAC name: 6-bromoquinoline-8-sulfonyl chloride. InChIKey: GKHOYDOQDYWDGB-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO2S |
|---|---|
| Molecular weight | 306.56 g/mol |
| IUPAC name | 6-bromoquinoline-8-sulfonyl chloride |
| InChIKey | GKHOYDOQDYWDGB-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)