CAS 870238-39-4 is the registry number for Methyl 4–bromo–7–chlorothieno(2,3–c)pyridine–2–carboxylate. Offered by: GLPBio. Available pack sizes: 250mg.
Methyl 4-bromo-7-chlorothieno[2,3-c]pyridine-2-carboxylate (CAS 870238-39-4) is a chemical compound with the molecular formula C9H5BrClNO2S and a molecular weight of 306.56 g/mol. IUPAC name: methyl 4-bromo-7-chlorothieno[2,3-c]pyridine-2-carboxylate. InChIKey: PLXPYNYEFDAWIJ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO2S |
|---|---|
| Molecular weight | 306.56 g/mol |
| IUPAC name | methyl 4-bromo-7-chlorothieno[2,3-c]pyridine-2-carboxylate |
| InChIKey | PLXPYNYEFDAWIJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)C(=NC=C2Br)Cl |
Computed by PubChem (NCBI)