CAS 1403766-69-7 appears in our catalog under these names: 5-Azaspiro[3.4]octane hemioxalate, 95%, 5-Azaspiro(3.4)octane oxalate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g.
5-azaspiro[3.4]octane;oxalic acid (CAS 1403766-69-7) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: 5-azaspiro[3.4]octane;oxalic acid. InChIKey: RUFZMAAVKZWUHW-UHFFFAOYSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 5-azaspiro[3.4]octane;oxalic acid |
| InChIKey | RUFZMAAVKZWUHW-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CCCN2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)