CAS 1403849-68-2 appears in our catalog under these names: (E)-5-(3-Fluoro-4-hydroxystyryl)benzene-1,3-diol, 97%, 97%, (E)-5-(3-Fluoro-4-hydroxystyryl)benzene-1,3-diol, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 5mg, 10mg.
5-[(E)-2-(3-fluoro-4-hydroxyphenyl)ethenyl]benzene-1,3-diol (CAS 1403849-68-2) is a chemical compound with the molecular formula C14H11FO3 and a molecular weight of 246.23 g/mol. IUPAC name: 5-[(E)-2-(3-fluoro-4-hydroxyphenyl)ethenyl]benzene-1,3-diol. InChIKey: VDUXKKFOASWEKM-OWOJBTEDSA-N.
| Molecular formula | C14H11FO3 |
|---|---|
| Molecular weight | 246.23 g/mol |
| IUPAC name | 5-[(E)-2-(3-fluoro-4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| InChIKey | VDUXKKFOASWEKM-OWOJBTEDSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C2=CC(=CC(=C2)O)O)F)O |
Computed by PubChem (NCBI)