CAS 1404196-36-6 is the registry number for (3,4)-Trans-1-(benzyloxycarbonyl)-3-fluoropiperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3R,4R)-3-fluoro-1-phenylmethoxycarbonylpiperidine-4-carboxylic acid (CAS 1404196-36-6) is a chemical compound with the molecular formula C14H16FNO4 and a molecular weight of 281.28 g/mol. IUPAC name: (3R,4R)-3-fluoro-1-phenylmethoxycarbonylpiperidine-4-carboxylic acid. InChIKey: SLRHMRLLMPLETF-RYUDHWBXSA-N.
| Molecular formula | C14H16FNO4 |
|---|---|
| Molecular weight | 281.28 g/mol |
| IUPAC name | (3R,4R)-3-fluoro-1-phenylmethoxycarbonylpiperidine-4-carboxylic acid |
| InChIKey | SLRHMRLLMPLETF-RYUDHWBXSA-N |
| SMILES | C1CN(C[C@@H]([C@H]1C(=O)O)F)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)