CAS 2281857-75-6 is the registry number for (3S,4S)-1-((Benzyloxy)carbonyl)-4-(fluoromethyl)pyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4S)-4-(fluoromethyl)-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid (CAS 2281857-75-6) is a chemical compound with the molecular formula C14H16FNO4 and a molecular weight of 281.28 g/mol. IUPAC name: (3S,4S)-4-(fluoromethyl)-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid. InChIKey: BHNFCXGGUYHREY-VXGBXAGGSA-N.
| Molecular formula | C14H16FNO4 |
|---|---|
| Molecular weight | 281.28 g/mol |
| IUPAC name | (3S,4S)-4-(fluoromethyl)-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid |
| InChIKey | BHNFCXGGUYHREY-VXGBXAGGSA-N |
| SMILES | C1[C@H]([C@@H](CN1C(=O)OCC2=CC=CC=C2)C(=O)O)CF |
Computed by PubChem (NCBI)