CAS 2115043-52-0 appears in our catalog under these names: O1-Benzyl o3-methyl 3-fluoropyrrolidine-1,3-dicarboxylate, 95%, 3-Methyl 1-(phenylmethyl) 3-fluoro-1,3-pyrrolidinedicarboxylate, 97%, 97%, O1-Benzyl O3-methyl 3-fluoropyrrolidine-1,3-dicarboxylate, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg, 25g, 10g.
1-O-benzyl 3-O-methyl 3-fluoropyrrolidine-1,3-dicarboxylate (CAS 2115043-52-0) is a chemical compound with the molecular formula C14H16FNO4 and a molecular weight of 281.28 g/mol. IUPAC name: 1-O-benzyl 3-O-methyl 3-fluoropyrrolidine-1,3-dicarboxylate. InChIKey: HPULGMAZTXERJB-UHFFFAOYSA-N.
| Molecular formula | C14H16FNO4 |
|---|---|
| Molecular weight | 281.28 g/mol |
| IUPAC name | 1-O-benzyl 3-O-methyl 3-fluoropyrrolidine-1,3-dicarboxylate |
| InChIKey | HPULGMAZTXERJB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCN(C1)C(=O)OCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)