CAS 2512199-79-8 appears in our catalog under these names: 1-Benzyl 3-methyl (S)-3-fluoropyrrolidine-1,3-dicarboxylate, 95%, O1-benzyl O3-methyl (3S)-3-fluoropyrrolidine-1,3-dicarboxylate, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g.
1-O-benzyl 3-O-methyl (3S)-3-fluoropyrrolidine-1,3-dicarboxylate (CAS 2512199-79-8) is a chemical compound with the molecular formula C14H16FNO4 and a molecular weight of 281.28 g/mol. IUPAC name: 1-O-benzyl 3-O-methyl (3S)-3-fluoropyrrolidine-1,3-dicarboxylate. InChIKey: HPULGMAZTXERJB-AWEZNQCLSA-N.
| Molecular formula | C14H16FNO4 |
|---|---|
| Molecular weight | 281.28 g/mol |
| IUPAC name | 1-O-benzyl 3-O-methyl (3S)-3-fluoropyrrolidine-1,3-dicarboxylate |
| InChIKey | HPULGMAZTXERJB-AWEZNQCLSA-N |
| SMILES | COC(=O)[C@@]1(CCN(C1)C(=O)OCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)