Products 1404453-63-9
CAS 1404453-63-9 appears in our catalog under these names: Glycopyrrolate Impurity 42, 2–Cyclopenten–1–yl(hydroxy)phenylacetic acid. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 100mg.
2-cyclopent-2-en-1-yl-2-hydroxy-2-phenylacetic acid (CAS 1404453-63-9) is a chemical compound with the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. IUPAC name: 2-cyclopent-2-en-1-yl-2-hydroxy-2-phenylacetic acid. InChIKey: IOMAYVVLKZFKHM-UHFFFAOYSA-N.
| Molecular formula | C13H14O3 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 2-cyclopent-2-en-1-yl-2-hydroxy-2-phenylacetic acid |
| InChIKey | IOMAYVVLKZFKHM-UHFFFAOYSA-N |
| SMILES | C1CC(C=C1)C(C2=CC=CC=C2)(C(=O)O)O |
Computed by PubChem (NCBI)