Products 140447-14-9
CAS 140447-14-9 appears in our catalog under these names: 11–Hydroxyjasmonic acid, (11S)-(-)-Hydroxyjasmonic acid, 11-Hydroxyjasmonic acid, 95%, 95%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, Get quote.
2-[(1R,2R)-2-[(Z,4S)-4-hydroxypent-2-enyl]-3-oxocyclopentyl]acetic acid (CAS 140447-14-9) is a chemical compound with the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. IUPAC name: 2-[(1R,2R)-2-[(Z,4S)-4-hydroxypent-2-enyl]-3-oxocyclopentyl]acetic acid. InChIKey: KLPBEXRQJBKPDM-JQQSAOSDSA-N.
| Molecular formula | C12H18O4 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 2-[(1R,2R)-2-[(Z,4S)-4-hydroxypent-2-enyl]-3-oxocyclopentyl]acetic acid |
| InChIKey | KLPBEXRQJBKPDM-JQQSAOSDSA-N |
| SMILES | C[C@@H](/C=C\C[C@@H]1[C@H](CCC1=O)CC(=O)O)O |
Computed by PubChem (NCBI)