CAS 140451-91-8 appears in our catalog under these names: 2-Cyclobutyl-1-phenylethan-1-one, 98%, 2-Cyclobutyl-1-phenylethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-cyclobutyl-1-phenylethanone (CAS 140451-91-8) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: 2-cyclobutyl-1-phenylethanone. InChIKey: YVHVQVZHGGIEFS-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 2-cyclobutyl-1-phenylethanone |
| InChIKey | YVHVQVZHGGIEFS-UHFFFAOYSA-N |
| SMILES | C1CC(C1)CC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)