Products 1405390-88-6
CAS 1405390-88-6 is the registry number for 3-(2-Chloro-3,4-dimethoxyphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-chloro-3,4-dimethoxyphenyl)-2-oxopropanoic acid (CAS 1405390-88-6) is a chemical compound with the molecular formula C11H11ClO5 and a molecular weight of 258.65 g/mol. IUPAC name: 3-(2-chloro-3,4-dimethoxyphenyl)-2-oxopropanoic acid. InChIKey: YVNDCVHSMHAUHO-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO5 |
|---|---|
| Molecular weight | 258.65 g/mol |
| IUPAC name | 3-(2-chloro-3,4-dimethoxyphenyl)-2-oxopropanoic acid |
| InChIKey | YVNDCVHSMHAUHO-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CC(=O)C(=O)O)Cl)OC |
Computed by PubChem (NCBI)