Products 590395-59-8

CAS 590395-59-8 is the registry number for 2-(4-Chloro-2-formyl-6-methoxyphenoxy)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(4-chloro-2-formyl-6-methoxyphenoxy)propanoic acid (CAS 590395-59-8) is a chemical compound with the molecular formula C11H11ClO5 and a molecular weight of 258.65 g/mol. IUPAC name: 2-(4-chloro-2-formyl-6-methoxyphenoxy)propanoic acid. InChIKey: OURPQCNJIAYKOE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11ClO5
Molecular weight258.65 g/mol
IUPAC name2-(4-chloro-2-formyl-6-methoxyphenoxy)propanoic acid
InChIKeyOURPQCNJIAYKOE-UHFFFAOYSA-N
SMILESCC(C(=O)O)OC1=C(C=C(C=C1OC)Cl)C=O

Computed by PubChem (NCBI)