CAS 428836-03-7 appears in our catalog under these names: (2-Chloro-6-ethoxy-4-formylphenoxy)acetic Acid, 2-(2-Chloro-6-ethoxy-4-formylphenoxy)acetic acid, 98%, 2-(2-Chloro-6-ethoxy-4-formylphenoxy)acetic acid, (2-Chloro-6-ethoxy-4-formylphenoxy)acetic acid, 98%, 98%, (2-chloro-6-ethoxy-4-formylphenoxy)acetic acid, 97%. Offered by: TRC, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg, 500mg, 2.5g.
2-(2-chloro-6-ethoxy-4-formylphenoxy)acetic acid (CAS 428836-03-7) is a chemical compound with the molecular formula C11H11ClO5 and a molecular weight of 258.65 g/mol. IUPAC name: 2-(2-chloro-6-ethoxy-4-formylphenoxy)acetic acid. InChIKey: XHFZCETYAOULCG-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO5 |
|---|---|
| Molecular weight | 258.65 g/mol |
| IUPAC name | 2-(2-chloro-6-ethoxy-4-formylphenoxy)acetic acid |
| InChIKey | XHFZCETYAOULCG-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)C=O)Cl)OCC(=O)O |
Computed by PubChem (NCBI)