CAS 692279-86-0 appears in our catalog under these names: 2-(5-Chloro-2-ethoxy-4-formylphenoxy)acetic acid, 98%, 2-(5-Chloro-2-ethoxy-4-formylphenoxy)acetic acid, 2-(5-Chloro-2-ethoxy-4-formylphenoxy)acetic acid 98%, 2-(5-Chloro-2-ethoxy-4-formylphenoxy)acetic acid, 95%+, 95%+. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
2-(5-chloro-2-ethoxy-4-formylphenoxy)acetic acid (CAS 692279-86-0) is a chemical compound with the molecular formula C11H11ClO5 and a molecular weight of 258.65 g/mol. IUPAC name: 2-(5-chloro-2-ethoxy-4-formylphenoxy)acetic acid. InChIKey: OHIVEVOHOXOLRT-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO5 |
|---|---|
| Molecular weight | 258.65 g/mol |
| IUPAC name | 2-(5-chloro-2-ethoxy-4-formylphenoxy)acetic acid |
| InChIKey | OHIVEVOHOXOLRT-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1)C=O)Cl)OCC(=O)O |
Computed by PubChem (NCBI)