Products 14063-77-5
CAS 14063-77-5 appears in our catalog under these names: 3-Chloro-3-(p-chlorophenyl)acrolein, 95+%, 3-Chloro-3-(p-chlorophenyl)acrolein. Offered by: AmBeed, Fluorochem. Available pack sizes: 10g, 5g.
(Z)-3-chloro-3-(4-chlorophenyl)prop-2-enal (CAS 14063-77-5) is a chemical compound with the molecular formula C9H6Cl2O and a molecular weight of 201.05 g/mol. IUPAC name: (Z)-3-chloro-3-(4-chlorophenyl)prop-2-enal. InChIKey: IWQMAUVMLFGNGU-UITAMQMPSA-N.
| Molecular formula | C9H6Cl2O |
|---|---|
| Molecular weight | 201.05 g/mol |
| IUPAC name | (Z)-3-chloro-3-(4-chlorophenyl)prop-2-enal |
| InChIKey | IWQMAUVMLFGNGU-UITAMQMPSA-N |
| SMILES | C1=CC(=CC=C1/C(=C/C=O)/Cl)Cl |
Computed by PubChem (NCBI)