CAS 35086-82-9 appears in our catalog under these names: 2-Chlorocinnamoyl chloride, 97%, 2–Chlorocinnamoyl chloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 10g, 25g.
(E)-3-(2-chlorophenyl)prop-2-enoyl chloride (CAS 35086-82-9) is a chemical compound with the molecular formula C9H6Cl2O and a molecular weight of 201.05 g/mol. IUPAC name: (E)-3-(2-chlorophenyl)prop-2-enoyl chloride. InChIKey: ZAUFNZFFWDQKPL-AATRIKPKSA-N.
| Molecular formula | C9H6Cl2O |
|---|---|
| Molecular weight | 201.05 g/mol |
| IUPAC name | (E)-3-(2-chlorophenyl)prop-2-enoyl chloride |
| InChIKey | ZAUFNZFFWDQKPL-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C(=O)Cl)Cl |
Computed by PubChem (NCBI)