CAS 69392-64-9 appears in our catalog under these names: 4,5-Dichloro-2,3-dihydro-1h-inden-1-one, 95%, 4,5–Dichloro–2,3–dihydro–1H–inden–1–one, 4,5-Dichloro-2,3-dihydro-1H-inden-1-one, 4,5-Dichloro-2,3-dihydro-1H-inden-1-one 97%, 4,5-Dichloro-2,3-dihydro-1H-inden-1-one, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g, 2,5g.
4,5-dichloro-2,3-dihydroinden-1-one (CAS 69392-64-9) is a chemical compound with the molecular formula C9H6Cl2O and a molecular weight of 201.05 g/mol. IUPAC name: 4,5-dichloro-2,3-dihydroinden-1-one. InChIKey: KYWOFYRNDCXWHN-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O |
|---|---|
| Molecular weight | 201.05 g/mol |
| IUPAC name | 4,5-dichloro-2,3-dihydroinden-1-one |
| InChIKey | KYWOFYRNDCXWHN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)