Products 52397-81-6
CAS 52397-81-6 appears in our catalog under these names: 4,6–Dichloro–1–indanone, 4,6-Dichloro-2,3-dihydro-1H-inden-1-one, 4,6-Dichloro-2,3-dihydro-1H-inden-1-one 97%, 4,6-Dichloro-2,3-dihydro-1H-inden-1-one, 97%, 97%, 4,6-Dichloro-2,3-dihydro-1H-inden-1-one, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100g, 100mg, 250mg, 25g.
4,6-dichloro-2,3-dihydroinden-1-one (CAS 52397-81-6) is a chemical compound with the molecular formula C9H6Cl2O and a molecular weight of 201.05 g/mol. IUPAC name: 4,6-dichloro-2,3-dihydroinden-1-one. InChIKey: BIGNWTAXBIQGAZ-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O |
|---|---|
| Molecular weight | 201.05 g/mol |
| IUPAC name | 4,6-dichloro-2,3-dihydroinden-1-one |
| InChIKey | BIGNWTAXBIQGAZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)