CAS 14068-01-0 appears in our catalog under these names: 4-Chloro-n-(4-methylbenzenesulfonyl)benzamide, 95%, 4-Chloro-N-(4-methylbenzenesulfonyl)benzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
4-chloro-N-(4-methylphenyl)sulfonylbenzamide (CAS 14068-01-0) is a chemical compound with the molecular formula C14H12ClNO3S and a molecular weight of 309.8 g/mol. IUPAC name: 4-chloro-N-(4-methylphenyl)sulfonylbenzamide. InChIKey: XQIKDLZMAPIBJR-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO3S |
|---|---|
| Molecular weight | 309.8 g/mol |
| IUPAC name | 4-chloro-N-(4-methylphenyl)sulfonylbenzamide |
| InChIKey | XQIKDLZMAPIBJR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)