CAS 648859-85-2 is the registry number for Methyl 2-([3-(chloromethyl)benzoyl]amino)thiophene-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.
Methyl 2-[[3-(chloromethyl)benzoyl]amino]thiophene-3-carboxylate (CAS 648859-85-2) is a chemical compound with the molecular formula C14H12ClNO3S and a molecular weight of 309.8 g/mol. IUPAC name: methyl 2-[[3-(chloromethyl)benzoyl]amino]thiophene-3-carboxylate. InChIKey: YOVSCTKBQMYDQN-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO3S |
|---|---|
| Molecular weight | 309.8 g/mol |
| IUPAC name | methyl 2-[[3-(chloromethyl)benzoyl]amino]thiophene-3-carboxylate |
| InChIKey | YOVSCTKBQMYDQN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(SC=C1)NC(=O)C2=CC=CC(=C2)CCl |
Computed by PubChem (NCBI)