CAS 728864-73-1 is the registry number for 4-Benzamido-2-methylbenzene-1-sulfonyl chloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-benzamido-2-methylbenzenesulfonyl chloride (CAS 728864-73-1) is a chemical compound with the molecular formula C14H12ClNO3S and a molecular weight of 309.8 g/mol. IUPAC name: 4-benzamido-2-methylbenzenesulfonyl chloride. InChIKey: SIYWYGVVVVTSGI-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO3S |
|---|---|
| Molecular weight | 309.8 g/mol |
| IUPAC name | 4-benzamido-2-methylbenzenesulfonyl chloride |
| InChIKey | SIYWYGVVVVTSGI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)C2=CC=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)