Products 6630-10-0
CAS 6630-10-0 is the registry number for N-[4-(4-Chlorophenyl)sulfonylphenyl]acetamide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
N-[4-(4-chlorophenyl)sulfonylphenyl]acetamide (CAS 6630-10-0) is a chemical compound with the molecular formula C14H12ClNO3S and a molecular weight of 309.8 g/mol. IUPAC name: N-[4-(4-chlorophenyl)sulfonylphenyl]acetamide. InChIKey: HJVPWOGNIQFJIG-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO3S |
|---|---|
| Molecular weight | 309.8 g/mol |
| IUPAC name | N-[4-(4-chlorophenyl)sulfonylphenyl]acetamide |
| InChIKey | HJVPWOGNIQFJIG-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)