Products 140694-58-2
CAS 140694-58-2 is the registry number for Senkyunolide N, 99.16%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg.
(3S,6S,7S)-3-butyl-6,7-dihydroxy-4,5,6,7-tetrahydro-3H-2-benzofuran-1-one (CAS 140694-58-2) is a chemical compound with the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. IUPAC name: (3S,6S,7S)-3-butyl-6,7-dihydroxy-4,5,6,7-tetrahydro-3H-2-benzofuran-1-one. InChIKey: AXRIHSJZHOTGAE-ATZCPNFKSA-N.
| Molecular formula | C12H18O4 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | (3S,6S,7S)-3-butyl-6,7-dihydroxy-4,5,6,7-tetrahydro-3H-2-benzofuran-1-one |
| InChIKey | AXRIHSJZHOTGAE-ATZCPNFKSA-N |
| SMILES | CCCC[C@H]1C2=C([C@@H]([C@H](CC2)O)O)C(=O)O1 |
Computed by PubChem (NCBI)