CAS 1408074-85-0 is the registry number for tert-Butyl exo-8-azabicyclo(3.2.1)octan-2-ylcarbamate, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl N-[(1R,2S,5S)-8-azabicyclo[3.2.1]octan-2-yl]carbamate (CAS 1408074-85-0) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl N-[(1R,2S,5S)-8-azabicyclo[3.2.1]octan-2-yl]carbamate. InChIKey: KAZCIFZEEFNPOF-AEJSXWLSSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl N-[(1R,2S,5S)-8-azabicyclo[3.2.1]octan-2-yl]carbamate |
| InChIKey | KAZCIFZEEFNPOF-AEJSXWLSSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@@H]2CC[C@H]1N2 |
Computed by PubChem (NCBI)