Products 1408076-01-6
CAS 1408076-01-6 appears in our catalog under these names: endo–2–(Boc–amino)–8–azabicyclo(3·2·1)octane, endo-2-(Boc-amino)-8-azabicyclo[3.2.1]octane, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g.
Tert-butyl N-[(1R,2R,5S)-8-azabicyclo[3.2.1]octan-2-yl]carbamate (CAS 1408076-01-6) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl N-[(1R,2R,5S)-8-azabicyclo[3.2.1]octan-2-yl]carbamate. InChIKey: KAZCIFZEEFNPOF-IVZWLZJFSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl N-[(1R,2R,5S)-8-azabicyclo[3.2.1]octan-2-yl]carbamate |
| InChIKey | KAZCIFZEEFNPOF-IVZWLZJFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H]2CC[C@H]1N2 |
Computed by PubChem (NCBI)