Products 1408075-03-5

CAS 1408075-03-5 is the registry number for 6-Boc-2,6-diazabicyclo[3.2.0]heptane, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 2,6-diazabicyclo[3.2.0]heptane-6-carboxylate (CAS 1408075-03-5) is a chemical compound with the molecular formula C10H18N2O2 and a molecular weight of 198.26 g/mol. IUPAC name: tert-butyl 2,6-diazabicyclo[3.2.0]heptane-6-carboxylate. InChIKey: BDVMAANWMDTLFP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18N2O2
Molecular weight198.26 g/mol
IUPAC nametert-butyl 2,6-diazabicyclo[3.2.0]heptane-6-carboxylate
InChIKeyBDVMAANWMDTLFP-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC2C1CCN2

Computed by PubChem (NCBI)